C17H17NO3 — CID 138656153
(1S,5R,14R,15S)-13-oxa-4-azahexacyclo[10.6.1.01,14.02,6.05,18.08,19]nonadeca-8(19),9,11,16-tetraene-11,15-diol (PubChem CID 138656153) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (1S,5R,14R,15S)-13-oxa-4-azahexacyclo[10.6.1.01,14.02,6.05,18.08,19]nonadeca-8(19),9,11,16-tetraene-11,15-diol.
| Compound Name | (1S,5R,14R,15S)-13-oxa-4-azahexacyclo[10.6.1.01,14.02,6.05,18.08,19]nonadeca-8(19),9,11,16-tetraene-11,15-diol |
|---|---|
| PubChem CID | 138656153 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (1S,5R,14R,15S)-13-oxa-4-azahexacyclo[10.6.1.01,14.02,6.05,18.08,19]nonadeca-8(19),9,11,16-tetraene-11,15-diol |
| SMILES | Oc1ccc2c3c1O[C@H]1[C@@H](O)C=CC4[C@@H]5NCC(C5C2)[C@@]341 |
| InChI | InChI=1S/C17H17NO3/c19-11-3-1-7-5-8-10-6-18-14(8)9-2-4-12(20)16-17(9,10)13(7)15(11)21-16/h1-4,8-10,12,14,16,18-20H,5-6H2/t8?,9?,10?,12-,14+,16-,17+/m0/s1 |
| InChIKey | CJKLSAHXAGKMIV-CHPFTLOZSA-N |
| XLogP | 0.71 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|