C19H33N3O2 — CID 70661710
3-hydroxy-N-[3-[methyl-[3-(2-methylbutan-2-ylamino)propyl]amino]propyl]benzamide (PubChem CID 70661710) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 3-hydroxy-N-[3-[methyl-[3-(2-methylbutan-2-ylamino)propyl]amino]propyl]benzamide.
| Compound Name | 3-hydroxy-N-[3-[methyl-[3-(2-methylbutan-2-ylamino)propyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 70661710 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 3-hydroxy-N-[3-[methyl-[3-(2-methylbutan-2-ylamino)propyl]amino]propyl]benzamide |
| SMILES | CCC(C)(C)NCCCN(C)CCCNC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C19H33N3O2/c1-5-19(2,3)21-12-8-14-22(4)13-7-11-20-18(24)16-9-6-10-17(23)15-16/h6,9-10,15,21,23H,5,7-8,11-14H2,1-4H3,(H,20,24) |
| InChIKey | YHENZGBMEXLDCF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|