C20H34N2O4 — CID 175439236
8-[(3-hydroxybenzoyl)amino]octanoic acid;2-methylbutan-2-amine (PubChem CID 175439236) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is 8-[(3-hydroxybenzoyl)amino]octanoic acid;2-methylbutan-2-amine.
| Compound Name | 8-[(3-hydroxybenzoyl)amino]octanoic acid;2-methylbutan-2-amine |
|---|---|
| PubChem CID | 175439236 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 8-[(3-hydroxybenzoyl)amino]octanoic acid;2-methylbutan-2-amine |
| SMILES | CCC(C)(C)N.O=C(O)CCCCCCCNC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C15H21NO4.C5H13N/c17-13-8-6-7-12(11-13)15(20)16-10-5-3-1-2-4-9-14(18)19;1-4-5(2,3)6/h6-8,11,17H,1-5,9-10H2,(H,16,20)(H,18,19);4,6H2,1-3H3 |
| InChIKey | KGFXDYCKSOXPCF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|