C33H43N3O3Si — CID 70662709
(3Z)-8-[tert-butyl(dimethyl)silyl]oxy-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-phenyl-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one (PubChem CID 70662709) has the molecular formula C33H43N3O3Si and a molecular weight of 557.81 g/mol. Its IUPAC name is (3Z)-8-[tert-butyl(dimethyl)silyl]oxy-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-phenyl-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one.
| Compound Name | (3Z)-8-[tert-butyl(dimethyl)silyl]oxy-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-phenyl-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one |
|---|---|
| PubChem CID | 70662709 |
| Molecular Formula | C33H43N3O3Si |
| Molecular Weight | 557.81 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | (3Z)-8-[tert-butyl(dimethyl)silyl]oxy-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6-phenyl-2,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one |
| SMILES | COc1cc(/C=C2/CCC3CC(O[Si](C)(C)C(C)(C)C)CC(c4ccccc4)N3C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C33H43N3O3Si/c1-23-21-35(22-34-23)29-16-13-24(18-31(29)38-5)17-26-14-15-27-19-28(39-40(6,7)33(2,3)4)20-30(36(27)32(26)37)25-11-9-8-10-12-25/h8-13,16-18,21-22,27-28,30H,14-15,19-20H2,1-7H3/b26-17- |
| InChIKey | HEUNJDISVPTWPA-ONUIUJJFSA-N |
| XLogP | 7.49 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.81 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|