C18H17N3 — CID 70665226
3-N-methyl-4-(3-phenylphenyl)pyridine-2,3-diamine (PubChem CID 70665226) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is 3-N-methyl-4-(3-phenylphenyl)pyridine-2,3-diamine.
| Compound Name | 3-N-methyl-4-(3-phenylphenyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 70665226 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 3-N-methyl-4-(3-phenylphenyl)pyridine-2,3-diamine |
| SMILES | CNc1c(-c2cccc(-c3ccccc3)c2)ccnc1N |
| InChI | InChI=1S/C18H17N3/c1-20-17-16(10-11-21-18(17)19)15-9-5-8-14(12-15)13-6-3-2-4-7-13/h2-12,20H,1H3,(H2,19,21) |
| InChIKey | DKYGMGVBNJOCHQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |