About 2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile
2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 70672877) has the molecular formula C15H18F3N3O
and a molecular weight of 313.32 g/mol. Its IUPAC name is 2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile |
| PubChem CID | 70672877 |
| Molecular Formula | C15H18F3N3O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CC(C)(C)[C@H]1CN(c2nc(C(F)(F)F)ccc2C#N)C[C@H]1O |
| InChI | InChI=1S/C15H18F3N3O/c1-14(2,3)10-7-21(8-11(10)22)13-9(6-19)4-5-12(20-13)15(16,17)18/h4-5,10-11,22H,7-8H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | DLYYXTTXPSHMHS-WDEREUQCSA-N |
| XLogP | 2.82 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile?
The IUPAC name of 2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile (CID 70672877) is 2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile.
What is the SMILES notation for 2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile?
The canonical SMILES for 2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile is CC(C)(C)[C@H]1CN(c2nc(C(F)(F)F)ccc2C#N)C[C@H]1O.
What is the InChIKey of 2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile?
The InChIKey is DLYYXTTXPSHMHS-WDEREUQCSA-N. The full InChI is InChI=1S/C15H18F3N3O/c1-14(2,3)10-7-21(8-11(10)22)13-9(6-19)4-5-12(20-13)15(16,17)18/h4-5,10-11,22H,7-8H2,1-3H3/t10-,11+/m0/s1.
What are the key properties of 2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile?
2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile has a molecular weight of 313.32 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4S)-3-tert-butyl-4-hydroxypyrrolidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile is sourced from PubChem (CID 70672877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).