C19H22N4O5S — CID 7068365
5-[[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]methyliminomethyl]-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7068365) has the molecular formula C19H22N4O5S and a molecular weight of 418.48 g/mol. Its IUPAC name is 5-[[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]methyliminomethyl]-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]methyliminomethyl]-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7068365 |
| Molecular Formula | C19H22N4O5S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 5-[[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]methyliminomethyl]-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1c2c(cc3c1[C@@H](C/N=C/C1C(=O)NC(=S)N(C)C1=O)N(C)CC3)OCO2 |
| InChI | InChI=1S/C19H22N4O5S/c1-22-5-4-10-6-13-15(28-9-27-13)16(26-3)14(10)12(22)8-20-7-11-17(24)21-19(29)23(2)18(11)25/h6-7,11-12H,4-5,8-9H2,1-3H3,(H,21,24,29)/b20-7+/t11?,12-/m1/s1 |
| InChIKey | BIXQHNMWXKZNPF-XQRWKLTNSA-N |
| XLogP | 0.51 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|