C19H16Br2N2O3 — CID 70683955
ethyl 4-(4-bromoanilino)-1-(4-bromophenyl)-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 70683955) has the molecular formula C19H16Br2N2O3 and a molecular weight of 480.16 g/mol. Its IUPAC name is ethyl 4-(4-bromoanilino)-1-(4-bromophenyl)-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-(4-bromoanilino)-1-(4-bromophenyl)-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 70683955 |
| Molecular Formula | C19H16Br2N2O3 |
| Molecular Weight | 480.16 g/mol |
| Exact Mass | 477.95 |
| IUPAC Name | ethyl 4-(4-bromoanilino)-1-(4-bromophenyl)-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(Nc2ccc(Br)cc2)C(=O)N(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C19H16Br2N2O3/c1-2-26-19(25)16-11-23(15-9-5-13(21)6-10-15)18(24)17(16)22-14-7-3-12(20)4-8-14/h3-10,22H,2,11H2,1H3 |
| InChIKey | RZDKWSKABPGJEG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.16 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |