C22H28N3O5+ — CID 7068404
(Z)-4-hydroxy-1-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-4-(1,3,5-trimethylpyrazol-4-yl)but-3-en-2-one (PubChem CID 7068404) has the molecular formula C22H28N3O5+ and a molecular weight of 414.48 g/mol. Its IUPAC name is (Z)-4-hydroxy-1-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-4-(1,3,5-trimethylpyrazol-4-yl)but-3-en-2-one.
| Compound Name | (Z)-4-hydroxy-1-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-4-(1,3,5-trimethylpyrazol-4-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 7068404 |
| Molecular Formula | C22H28N3O5+ |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (Z)-4-hydroxy-1-[(5S)-4-methoxy-6-methyl-5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-yl]-4-(1,3,5-trimethylpyrazol-4-yl)but-3-en-2-one |
| SMILES | COc1c2c(cc3c1[C@H](CC(=O)/C=C(\O)c1c(C)nn(C)c1C)[NH+](C)CC3)OCO2 |
| InChI | InChI=1S/C22H27N3O5/c1-12-19(13(2)25(4)23-12)17(27)10-15(26)9-16-20-14(6-7-24(16)3)8-18-21(22(20)28-5)30-11-29-18/h8,10,16,27H,6-7,9,11H2,1-5H3/p+1/b17-10-/t16-/m0/s1 |
| InChIKey | ODDUQCKYVMRHTE-IUPCOXQMSA-O |
| XLogP | 1.44 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|