C28H29F3N4O3 — CID 70687537
(E)-N-[2-(4-cyclopropyl-4-hydroxypiperidin-1-yl)-4-methylquinazolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]but-2-enamide (PubChem CID 70687537) has the molecular formula C28H29F3N4O3 and a molecular weight of 526.56 g/mol. Its IUPAC name is (E)-N-[2-(4-cyclopropyl-4-hydroxypiperidin-1-yl)-4-methylquinazolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]but-2-enamide.
| Compound Name | (E)-N-[2-(4-cyclopropyl-4-hydroxypiperidin-1-yl)-4-methylquinazolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 70687537 |
| Molecular Formula | C28H29F3N4O3 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (E)-N-[2-(4-cyclopropyl-4-hydroxypiperidin-1-yl)-4-methylquinazolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]but-2-enamide |
| SMILES | C/C(=C\C(=O)Nc1ccc2nc(N3CCC(O)(C4CC4)CC3)nc(C)c2c1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C28H29F3N4O3/c1-17(19-3-8-22(9-4-19)38-28(29,30)31)15-25(36)33-21-7-10-24-23(16-21)18(2)32-26(34-24)35-13-11-27(37,12-14-35)20-5-6-20/h3-4,7-10,15-16,20,37H,5-6,11-14H2,1-2H3,(H,33,36)/b17-15+ |
| InChIKey | CRNYTOLQVBUHQR-BMRADRMJSA-N |
| XLogP | 5.62 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|