C26H26F3N5O3 — CID 70691725
N-cyclopropyl-4-[[4-methyl-6-[[(E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]quinazolin-2-yl]amino]butanamide (PubChem CID 70691725) has the molecular formula C26H26F3N5O3 and a molecular weight of 513.52 g/mol. Its IUPAC name is N-cyclopropyl-4-[[4-methyl-6-[[(E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]quinazolin-2-yl]amino]butanamide.
| Compound Name | N-cyclopropyl-4-[[4-methyl-6-[[(E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]quinazolin-2-yl]amino]butanamide |
|---|---|
| PubChem CID | 70691725 |
| Molecular Formula | C26H26F3N5O3 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | N-cyclopropyl-4-[[4-methyl-6-[[(E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]quinazolin-2-yl]amino]butanamide |
| SMILES | Cc1nc(NCCCC(=O)NC2CC2)nc2ccc(NC(=O)/C=C/c3ccc(OC(F)(F)F)cc3)cc12 |
| InChI | InChI=1S/C26H26F3N5O3/c1-16-21-15-19(33-24(36)13-6-17-4-10-20(11-5-17)37-26(27,28)29)9-12-22(21)34-25(31-16)30-14-2-3-23(35)32-18-7-8-18/h4-6,9-13,15,18H,2-3,7-8,14H2,1H3,(H,32,35)(H,33,36)(H,30,31,34)/b13-6+ |
| InChIKey | LIMSYQVSIDVCNQ-AWNIVKPZSA-N |
| XLogP | 4.96 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|