C24H25F3N4O2 — CID 58646160
(E)-N-[4-methyl-2-[methyl-[2-(methylamino)ethyl]amino]quinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 58646160) has the molecular formula C24H25F3N4O2 and a molecular weight of 458.48 g/mol. Its IUPAC name is (E)-N-[4-methyl-2-[methyl-[2-(methylamino)ethyl]amino]quinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-methyl-2-[methyl-[2-(methylamino)ethyl]amino]quinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 58646160 |
| Molecular Formula | C24H25F3N4O2 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | (E)-N-[4-methyl-2-[methyl-[2-(methylamino)ethyl]amino]quinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | CNCCN(C)c1cc(C)c2cc(NC(=O)/C=C/c3ccc(OC(F)(F)F)cc3)ccc2n1 |
| InChI | InChI=1S/C24H25F3N4O2/c1-16-14-22(31(3)13-12-28-2)30-21-10-7-18(15-20(16)21)29-23(32)11-6-17-4-8-19(9-5-17)33-24(25,26)27/h4-11,14-15,28H,12-13H2,1-3H3,(H,29,32)/b11-6+ |
| InChIKey | DCGITXIDTZEOEM-IZZDOVSWSA-N |
| XLogP | 4.75 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|