C26H29F3N4O2 — CID 58646208
(E)-N-[2-[2-(diethylamino)ethylamino]-4-methylquinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 58646208) has the molecular formula C26H29F3N4O2 and a molecular weight of 486.54 g/mol. Its IUPAC name is (E)-N-[2-[2-(diethylamino)ethylamino]-4-methylquinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-[2-(diethylamino)ethylamino]-4-methylquinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 58646208 |
| Molecular Formula | C26H29F3N4O2 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | (E)-N-[2-[2-(diethylamino)ethylamino]-4-methylquinolin-6-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | CCN(CC)CCNc1cc(C)c2cc(NC(=O)/C=C/c3ccc(OC(F)(F)F)cc3)ccc2n1 |
| InChI | InChI=1S/C26H29F3N4O2/c1-4-33(5-2)15-14-30-24-16-18(3)22-17-20(9-12-23(22)32-24)31-25(34)13-8-19-6-10-21(11-7-19)35-26(27,28)29/h6-13,16-17H,4-5,14-15H2,1-3H3,(H,30,32)(H,31,34)/b13-8+ |
| InChIKey | ZWCVERCKWONNGF-MDWZMJQESA-N |
| XLogP | 5.85 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|