C23H18FNO5 — CID 70690274
(Z)-4-[5-benzyl-1-[(3-fluorophenyl)methyl]-2-oxo-3-pyridinyl]-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 70690274) has the molecular formula C23H18FNO5 and a molecular weight of 407.40 g/mol. Its IUPAC name is (Z)-4-[5-benzyl-1-[(3-fluorophenyl)methyl]-2-oxo-3-pyridinyl]-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | (Z)-4-[5-benzyl-1-[(3-fluorophenyl)methyl]-2-oxo-3-pyridinyl]-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 70690274 |
| Molecular Formula | C23H18FNO5 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | (Z)-4-[5-benzyl-1-[(3-fluorophenyl)methyl]-2-oxo-3-pyridinyl]-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | O=C(O)C(=O)/C=C(\O)c1cc(Cc2ccccc2)cn(Cc2cccc(F)c2)c1=O |
| InChI | InChI=1S/C23H18FNO5/c24-18-8-4-7-16(10-18)13-25-14-17(9-15-5-2-1-3-6-15)11-19(22(25)28)20(26)12-21(27)23(29)30/h1-8,10-12,14,26H,9,13H2,(H,29,30)/b20-12- |
| InChIKey | HKZARADKHIHMSA-NDENLUEZSA-N |
| XLogP | 3.18 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|