C32H34N2O7 — CID 70692136
methyl (1R,9S,10S,12S,13Z,16S,18S)-18-acetyloxy-8-(3,4-dimethoxybenzoyl)-13-ethylidene-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-17-carboxylate (PubChem CID 70692136) has the molecular formula C32H34N2O7 and a molecular weight of 558.63 g/mol. Its IUPAC name is methyl (1R,9S,10S,12S,13Z,16S,18S)-18-acetyloxy-8-(3,4-dimethoxybenzoyl)-13-ethylidene-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-17-carboxylate.
| Compound Name | methyl (1R,9S,10S,12S,13Z,16S,18S)-18-acetyloxy-8-(3,4-dimethoxybenzoyl)-13-ethylidene-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-17-carboxylate |
|---|---|
| PubChem CID | 70692136 |
| Molecular Formula | C32H34N2O7 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | methyl (1R,9S,10S,12S,13Z,16S,18S)-18-acetyloxy-8-(3,4-dimethoxybenzoyl)-13-ethylidene-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-17-carboxylate |
| SMILES | C/C=C1\CN2[C@H]3C[C@@]45c6ccccc6N(C(=O)c6ccc(OC)c(OC)c6)[C@@H]4[C@@H]2C[C@@H]1C3(C(=O)OC)[C@H]5OC(C)=O |
| InChI | InChI=1S/C32H34N2O7/c1-6-18-16-33-23-14-21(18)32(30(37)40-5)26(33)15-31(29(32)41-17(2)35)20-9-7-8-10-22(20)34(27(23)31)28(36)19-11-12-24(38-3)25(13-19)39-4/h6-13,21,23,26-27,29H,14-16H2,1-5H3/b18-6+/t21-,23-,26-,27+,29-,31+,32?/m0/s1 |
| InChIKey | OHBRMEZFQBFOIN-NCNFIERHSA-N |
| XLogP | 3.50 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|