C16H17N3O5S2 — CID 70693065
[2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazol-5-yl]-piperidin-1-ylmethanone (PubChem CID 70693065) has the molecular formula C16H17N3O5S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is [2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazol-5-yl]-piperidin-1-ylmethanone.
| Compound Name | [2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazol-5-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 70693065 |
| Molecular Formula | C16H17N3O5S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [2-(4-methylsulfonyl-3-nitrophenyl)-1,3-thiazol-5-yl]-piperidin-1-ylmethanone |
| SMILES | CS(=O)(=O)c1ccc(-c2ncc(C(=O)N3CCCCC3)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17N3O5S2/c1-26(23,24)14-6-5-11(9-12(14)19(21)22)15-17-10-13(25-15)16(20)18-7-3-2-4-8-18/h5-6,9-10H,2-4,7-8H2,1H3 |
| InChIKey | BOQKMRSJVMJBHK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 110.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|