C20H18N2O3S — CID 70694207
(2R)-3-(naphthalen-2-ylmethylsulfanyl)-2-(pyridine-2-carbonylamino)propanoic acid (PubChem CID 70694207) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is (2R)-3-(naphthalen-2-ylmethylsulfanyl)-2-(pyridine-2-carbonylamino)propanoic acid.
| Compound Name | (2R)-3-(naphthalen-2-ylmethylsulfanyl)-2-(pyridine-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 70694207 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (2R)-3-(naphthalen-2-ylmethylsulfanyl)-2-(pyridine-2-carbonylamino)propanoic acid |
| SMILES | O=C(N[C@@H](CSCc1ccc2ccccc2c1)C(=O)O)c1ccccn1 |
| InChI | InChI=1S/C20H18N2O3S/c23-19(17-7-3-4-10-21-17)22-18(20(24)25)13-26-12-14-8-9-15-5-1-2-6-16(15)11-14/h1-11,18H,12-13H2,(H,22,23)(H,24,25)/t18-/m0/s1 |
| InChIKey | FVOKHGLVKLJETQ-SFHVURJKSA-N |
| XLogP | 3.35 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |