C16H16N2O3S — CID 149150673
(2R)-2-[(2-phenylacetyl)amino]-3-pyridin-2-ylsulfanylpropanoic acid (PubChem CID 149150673) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is (2R)-2-[(2-phenylacetyl)amino]-3-pyridin-2-ylsulfanylpropanoic acid.
| Compound Name | (2R)-2-[(2-phenylacetyl)amino]-3-pyridin-2-ylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 149150673 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (2R)-2-[(2-phenylacetyl)amino]-3-pyridin-2-ylsulfanylpropanoic acid |
| SMILES | O=C(Cc1ccccc1)N[C@@H](CSc1ccccn1)C(=O)O |
| InChI | InChI=1S/C16H16N2O3S/c19-14(10-12-6-2-1-3-7-12)18-13(16(20)21)11-22-15-8-4-5-9-17-15/h1-9,13H,10-11H2,(H,18,19)(H,20,21)/t13-/m0/s1 |
| InChIKey | ORGPXPUFTOYFIE-ZDUSSCGKSA-N |
| XLogP | 1.99 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |