C19H19NO4 — CID 70694869
(Z)-2-hydroxy-4-oxo-4-[3-(3-phenylphenyl)propylamino]but-2-enoic acid (PubChem CID 70694869) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is (Z)-2-hydroxy-4-oxo-4-[3-(3-phenylphenyl)propylamino]but-2-enoic acid.
| Compound Name | (Z)-2-hydroxy-4-oxo-4-[3-(3-phenylphenyl)propylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 70694869 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (Z)-2-hydroxy-4-oxo-4-[3-(3-phenylphenyl)propylamino]but-2-enoic acid |
| SMILES | O=C(/C=C(\O)C(=O)O)NCCCc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H19NO4/c21-17(19(23)24)13-18(22)20-11-5-7-14-6-4-10-16(12-14)15-8-2-1-3-9-15/h1-4,6,8-10,12-13,21H,5,7,11H2,(H,20,22)(H,23,24)/b17-13- |
| InChIKey | YDROAFIKLXSCDX-LGMDPLHJSA-N |
| XLogP | 2.93 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|