C16H25N3O5S — CID 70706891
2-[(2S,3R)-2-amino-3-hydroxybutanoyl]-N-(2-methoxyethyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide (PubChem CID 70706891) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-[(2S,3R)-2-amino-3-hydroxybutanoyl]-N-(2-methoxyethyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide.
| Compound Name | 2-[(2S,3R)-2-amino-3-hydroxybutanoyl]-N-(2-methoxyethyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 70706891 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-[(2S,3R)-2-amino-3-hydroxybutanoyl]-N-(2-methoxyethyl)-3,4-dihydro-1H-isoquinoline-6-sulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc2c(c1)CCN(C(=O)[C@@H](N)[C@@H](C)O)C2 |
| InChI | InChI=1S/C16H25N3O5S/c1-11(20)15(17)16(21)19-7-5-12-9-14(4-3-13(12)10-19)25(22,23)18-6-8-24-2/h3-4,9,11,15,18,20H,5-8,10,17H2,1-2H3/t11-,15+/m1/s1 |
| InChIKey | ZOFOWJPNYSCBEQ-ABAIWWIYSA-N |
| XLogP | -0.80 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|