C17H22N4O4S — CID 70711846
1-[(4aR,7aS)-6,6-dioxo-1-(pyridin-2-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]cyclopropane-1-carboxamide (PubChem CID 70711846) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 1-[(4aR,7aS)-6,6-dioxo-1-(pyridin-2-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[(4aR,7aS)-6,6-dioxo-1-(pyridin-2-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 70711846 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-[(4aR,7aS)-6,6-dioxo-1-(pyridin-2-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]cyclopropane-1-carboxamide |
| SMILES | NC(=O)C1(C(=O)N2CCN(Cc3ccccn3)[C@@H]3CS(=O)(=O)C[C@@H]32)CC1 |
| InChI | InChI=1S/C17H22N4O4S/c18-15(22)17(4-5-17)16(23)21-8-7-20(9-12-3-1-2-6-19-12)13-10-26(24,25)11-14(13)21/h1-3,6,13-14H,4-5,7-11H2,(H2,18,22)/t13-,14+/m1/s1 |
| InChIKey | ATOKCDMYPLRFBF-KGLIPLIRSA-N |
| XLogP | -0.84 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|