C17H27N5O3S — CID 70761639
(4aR,7aS)-N-ethyl-6,6-dioxo-1-[(2-propan-2-ylpyrimidin-4-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide (PubChem CID 70761639) has the molecular formula C17H27N5O3S and a molecular weight of 381.50 g/mol. Its IUPAC name is (4aR,7aS)-N-ethyl-6,6-dioxo-1-[(2-propan-2-ylpyrimidin-4-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide.
| Compound Name | (4aR,7aS)-N-ethyl-6,6-dioxo-1-[(2-propan-2-ylpyrimidin-4-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 70761639 |
| Molecular Formula | C17H27N5O3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (4aR,7aS)-N-ethyl-6,6-dioxo-1-[(2-propan-2-ylpyrimidin-4-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
| SMILES | CCNC(=O)N1CCN(Cc2ccnc(C(C)C)n2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H27N5O3S/c1-4-18-17(23)22-8-7-21(14-10-26(24,25)11-15(14)22)9-13-5-6-19-16(20-13)12(2)3/h5-6,12,14-15H,4,7-11H2,1-3H3,(H,18,23)/t14-,15+/m1/s1 |
| InChIKey | FOBMNYVCABAHFN-CABCVRRESA-N |
| XLogP | 0.61 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |