C13H22N4O4S2 — CID 70712249
(4aS,7aR)-1-[(1-ethylimidazol-2-yl)methyl]-4-methylsulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70712249) has the molecular formula C13H22N4O4S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is (4aS,7aR)-1-[(1-ethylimidazol-2-yl)methyl]-4-methylsulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aS,7aR)-1-[(1-ethylimidazol-2-yl)methyl]-4-methylsulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70712249 |
| Molecular Formula | C13H22N4O4S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (4aS,7aR)-1-[(1-ethylimidazol-2-yl)methyl]-4-methylsulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CCn1ccnc1CN1CCN(S(C)(=O)=O)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C13H22N4O4S2/c1-3-15-5-4-14-13(15)8-16-6-7-17(22(2,18)19)12-10-23(20,21)9-11(12)16/h4-5,11-12H,3,6-10H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | JWHAWPMZMNBPQN-NWDGAFQWSA-N |
| XLogP | -0.85 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |