C15H24N4O4S2 — CID 70722834
(4aR,7aS)-1-(3-methylbut-2-enyl)-4-(1-methylimidazol-4-yl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70722834) has the molecular formula C15H24N4O4S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is (4aR,7aS)-1-(3-methylbut-2-enyl)-4-(1-methylimidazol-4-yl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-1-(3-methylbut-2-enyl)-4-(1-methylimidazol-4-yl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70722834 |
| Molecular Formula | C15H24N4O4S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (4aR,7aS)-1-(3-methylbut-2-enyl)-4-(1-methylimidazol-4-yl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CC(C)=CCN1CCN(S(=O)(=O)c2cn(C)cn2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H24N4O4S2/c1-12(2)4-5-18-6-7-19(14-10-24(20,21)9-13(14)18)25(22,23)15-8-17(3)11-16-15/h4,8,11,13-14H,5-7,9-10H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | ULAIBMYANYRVSH-KGLIPLIRSA-N |
| XLogP | -0.14 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|