C13H22N4O5S2 — CID 70714663
(4aR,7aS)-1-(2-methoxyethyl)-4-(1-methylimidazol-4-yl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70714663) has the molecular formula C13H22N4O5S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is (4aR,7aS)-1-(2-methoxyethyl)-4-(1-methylimidazol-4-yl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-1-(2-methoxyethyl)-4-(1-methylimidazol-4-yl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70714663 |
| Molecular Formula | C13H22N4O5S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | (4aR,7aS)-1-(2-methoxyethyl)-4-(1-methylimidazol-4-yl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | COCCN1CCN(S(=O)(=O)c2cn(C)cn2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C13H22N4O5S2/c1-15-7-13(14-10-15)24(20,21)17-4-3-16(5-6-22-2)11-8-23(18,19)9-12(11)17/h7,10-12H,3-6,8-9H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | AXLVMUYCOWDTFO-NEPJUHHUSA-N |
| XLogP | -1.46 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |