C10H17N3O2S2 — CID 71871349
2,6-dimethyl-4-(1-methylimidazol-4-yl)sulfonylthiomorpholine (PubChem CID 71871349) has the molecular formula C10H17N3O2S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 2,6-dimethyl-4-(1-methylimidazol-4-yl)sulfonylthiomorpholine.
| Compound Name | 2,6-dimethyl-4-(1-methylimidazol-4-yl)sulfonylthiomorpholine |
|---|---|
| PubChem CID | 71871349 |
| Molecular Formula | C10H17N3O2S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2,6-dimethyl-4-(1-methylimidazol-4-yl)sulfonylthiomorpholine |
| SMILES | CC1CN(S(=O)(=O)c2cn(C)cn2)CC(C)S1 |
| InChI | InChI=1S/C10H17N3O2S2/c1-8-4-13(5-9(2)16-8)17(14,15)10-6-12(3)7-11-10/h6-9H,4-5H2,1-3H3 |
| InChIKey | INDOHPFSEGTNTD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |