C18H27NO2 — CID 7071247
[(3S)-1-azabicyclo[2.2.2]octan-3-yl] adamantane-1-carboxylate (PubChem CID 7071247) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is [(3S)-1-azabicyclo[2.2.2]octan-3-yl] adamantane-1-carboxylate.
| Compound Name | [(3S)-1-azabicyclo[2.2.2]octan-3-yl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 7071247 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | [(3S)-1-azabicyclo[2.2.2]octan-3-yl] adamantane-1-carboxylate |
| SMILES | O=C(O[C@@H]1CN2CCC1CC2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H27NO2/c20-17(21-16-11-19-3-1-15(16)2-4-19)18-8-12-5-13(9-18)7-14(6-12)10-18/h12-16H,1-11H2/t12?,13?,14?,16-,18?/m1/s1 |
| InChIKey | MQTJTRXFDSDSOO-JKJYUFNASA-N |
| XLogP | 2.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |