C18H16FN3OS — CID 70713095
[2-(4-fluorophenyl)azetidin-1-yl]-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]methanone (PubChem CID 70713095) has the molecular formula C18H16FN3OS and a molecular weight of 341.41 g/mol. Its IUPAC name is [2-(4-fluorophenyl)azetidin-1-yl]-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]methanone.
| Compound Name | [2-(4-fluorophenyl)azetidin-1-yl]-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 70713095 |
| Molecular Formula | C18H16FN3OS |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [2-(4-fluorophenyl)azetidin-1-yl]-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]methanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCC3c3ccc(F)cc3)n[nH]2)s1 |
| InChI | InChI=1S/C18H16FN3OS/c1-11-2-7-17(24-11)14-10-15(21-20-14)18(23)22-9-8-16(22)12-3-5-13(19)6-4-12/h2-7,10,16H,8-9H2,1H3,(H,20,21) |
| InChIKey | CHHKURTWSSDJCF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |