C13H13N3O3S — CID 97284605
(2R)-1-[5-(5-methylthiophen-2-yl)-1H-pyrazole-3-carbonyl]azetidine-2-carboxylic acid (PubChem CID 97284605) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is (2R)-1-[5-(5-methylthiophen-2-yl)-1H-pyrazole-3-carbonyl]azetidine-2-carboxylic acid.
| Compound Name | (2R)-1-[5-(5-methylthiophen-2-yl)-1H-pyrazole-3-carbonyl]azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 97284605 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (2R)-1-[5-(5-methylthiophen-2-yl)-1H-pyrazole-3-carbonyl]azetidine-2-carboxylic acid |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CC[C@@H]3C(=O)O)n[nH]2)s1 |
| InChI | InChI=1S/C13H13N3O3S/c1-7-2-3-11(20-7)8-6-9(15-14-8)12(17)16-5-4-10(16)13(18)19/h2-3,6,10H,4-5H2,1H3,(H,14,15)(H,18,19)/t10-/m1/s1 |
| InChIKey | LANQYNCJLSEBRA-SNVBAGLBSA-N |
| XLogP | 1.75 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |