C10H11NO3S — CID 130645542
1-(5-methylthiophene-2-carbonyl)azetidine-2-carboxylic acid (PubChem CID 130645542) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is 1-(5-methylthiophene-2-carbonyl)azetidine-2-carboxylic acid.
| Compound Name | 1-(5-methylthiophene-2-carbonyl)azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 130645542 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 1-(5-methylthiophene-2-carbonyl)azetidine-2-carboxylic acid |
| SMILES | Cc1ccc(C(=O)N2CCC2C(=O)O)s1 |
| InChI | InChI=1S/C10H11NO3S/c1-6-2-3-8(15-6)9(12)11-5-4-7(11)10(13)14/h2-3,7H,4-5H2,1H3,(H,13,14) |
| InChIKey | FQAVBVWNMHMVOX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |