C20H26F2N2O2 — CID 70713127
2-butyl-8-(2,3-difluorobenzoyl)-2,8-diazaspiro[5.5]undecan-3-one (PubChem CID 70713127) has the molecular formula C20H26F2N2O2 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-butyl-8-(2,3-difluorobenzoyl)-2,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | 2-butyl-8-(2,3-difluorobenzoyl)-2,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 70713127 |
| Molecular Formula | C20H26F2N2O2 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2-butyl-8-(2,3-difluorobenzoyl)-2,8-diazaspiro[5.5]undecan-3-one |
| SMILES | CCCCN1CC2(CCCN(C(=O)c3cccc(F)c3F)C2)CCC1=O |
| InChI | InChI=1S/C20H26F2N2O2/c1-2-3-11-23-13-20(10-8-17(23)25)9-5-12-24(14-20)19(26)15-6-4-7-16(21)18(15)22/h4,6-7H,2-3,5,8-14H2,1H3 |
| InChIKey | OUFRSONNNYTCSW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |