C22H28N4O3 — CID 70756988
2-(3-methoxypropyl)-8-(quinoxaline-5-carbonyl)-2,8-diazaspiro[5.5]undecan-3-one (PubChem CID 70756988) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-8-(quinoxaline-5-carbonyl)-2,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | 2-(3-methoxypropyl)-8-(quinoxaline-5-carbonyl)-2,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 70756988 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-(3-methoxypropyl)-8-(quinoxaline-5-carbonyl)-2,8-diazaspiro[5.5]undecan-3-one |
| SMILES | COCCCN1CC2(CCCN(C(=O)c3cccc4nccnc34)C2)CCC1=O |
| InChI | InChI=1S/C22H28N4O3/c1-29-14-4-13-25-15-22(9-7-19(25)27)8-3-12-26(16-22)21(28)17-5-2-6-18-20(17)24-11-10-23-18/h2,5-6,10-11H,3-4,7-9,12-16H2,1H3 |
| InChIKey | KETCLYHAMXZOHV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|