C21H31N3O4 — CID 70757089
8-(2-ethoxypyridine-3-carbonyl)-2-(3-methoxypropyl)-2,8-diazaspiro[5.5]undecan-3-one (PubChem CID 70757089) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is 8-(2-ethoxypyridine-3-carbonyl)-2-(3-methoxypropyl)-2,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | 8-(2-ethoxypyridine-3-carbonyl)-2-(3-methoxypropyl)-2,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 70757089 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 8-(2-ethoxypyridine-3-carbonyl)-2-(3-methoxypropyl)-2,8-diazaspiro[5.5]undecan-3-one |
| SMILES | CCOc1ncccc1C(=O)N1CCCC2(CCC(=O)N(CCCOC)C2)C1 |
| InChI | InChI=1S/C21H31N3O4/c1-3-28-19-17(7-4-11-22-19)20(26)24-12-5-9-21(16-24)10-8-18(25)23(15-21)13-6-14-27-2/h4,7,11H,3,5-6,8-10,12-16H2,1-2H3 |
| InChIKey | UZCHLMJSGYFGHD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|