C17H19N3O4S — CID 70713375
[(4aR,7aS)-1-benzyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1,2-oxazol-3-yl)methanone (PubChem CID 70713375) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is [(4aR,7aS)-1-benzyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1,2-oxazol-3-yl)methanone.
| Compound Name | [(4aR,7aS)-1-benzyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 70713375 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | [(4aR,7aS)-1-benzyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1ccon1)N1CCN(Cc2ccccc2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H19N3O4S/c21-17(14-6-9-24-18-14)20-8-7-19(10-13-4-2-1-3-5-13)15-11-25(22,23)12-16(15)20/h1-6,9,15-16H,7-8,10-12H2/t15-,16+/m1/s1 |
| InChIKey | DBULOHUTKIGUCM-CVEARBPZSA-N |
| XLogP | 0.80 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |