C16H24N4O3S — CID 70715264
[(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-methyl-1H-pyrazol-3-yl)methanone (PubChem CID 70715264) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is [(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-methyl-1H-pyrazol-3-yl)methanone.
| Compound Name | [(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-methyl-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 70715264 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | [(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-methyl-1H-pyrazol-3-yl)methanone |
| SMILES | CC(C)=CCN1CCN(C(=O)c2cc(C)[nH]n2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H24N4O3S/c1-11(2)4-5-19-6-7-20(15-10-24(22,23)9-14(15)19)16(21)13-8-12(3)17-18-13/h4,8,14-15H,5-7,9-10H2,1-3H3,(H,17,18)/t14-,15+/m1/s1 |
| InChIKey | HNGNDDANGVBOMV-CABCVRRESA-N |
| XLogP | 0.61 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|