C16H22N4O2 — CID 70716640
6-[[(4-pyrazol-1-ylphenyl)methylamino]methyl]-1,4-oxazepan-6-ol (PubChem CID 70716640) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 6-[[(4-pyrazol-1-ylphenyl)methylamino]methyl]-1,4-oxazepan-6-ol.
| Compound Name | 6-[[(4-pyrazol-1-ylphenyl)methylamino]methyl]-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 70716640 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 6-[[(4-pyrazol-1-ylphenyl)methylamino]methyl]-1,4-oxazepan-6-ol |
| SMILES | OC1(CNCc2ccc(-n3cccn3)cc2)CNCCOC1 |
| InChI | InChI=1S/C16H22N4O2/c21-16(11-17-7-9-22-13-16)12-18-10-14-2-4-15(5-3-14)20-8-1-6-19-20/h1-6,8,17-18,21H,7,9-13H2 |
| InChIKey | XUBAJBIFURQLPB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |