C16H19N3O3 — CID 71967541
N-[(3-hydroxyoxolan-3-yl)methyl]-2-(4-pyrazol-1-ylphenyl)acetamide (PubChem CID 71967541) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[(3-hydroxyoxolan-3-yl)methyl]-2-(4-pyrazol-1-ylphenyl)acetamide.
| Compound Name | N-[(3-hydroxyoxolan-3-yl)methyl]-2-(4-pyrazol-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 71967541 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[(3-hydroxyoxolan-3-yl)methyl]-2-(4-pyrazol-1-ylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(-n2cccn2)cc1)NCC1(O)CCOC1 |
| InChI | InChI=1S/C16H19N3O3/c20-15(17-11-16(21)6-9-22-12-16)10-13-2-4-14(5-3-13)19-8-1-7-18-19/h1-5,7-8,21H,6,9-12H2,(H,17,20) |
| InChIKey | XOEHPQPOWNHMPX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |