C21H25O4- — CID 7071952
2-[2-[(4aR,6R,6aS,10bS)-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromen-6-yl]phenoxy]acetate (PubChem CID 7071952) has the molecular formula C21H25O4- and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-[2-[(4aR,6R,6aS,10bS)-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromen-6-yl]phenoxy]acetate.
| Compound Name | 2-[2-[(4aR,6R,6aS,10bS)-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromen-6-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 7071952 |
| Molecular Formula | C21H25O4- |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-[2-[(4aR,6R,6aS,10bS)-2,3,4,4a,6,6a,7,8,9,10b-decahydro-1H-benzo[c]chromen-6-yl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccccc1[C@@H]1O[C@@H]2CCCC[C@H]2C2=CCCC[C@@H]21 |
| InChI | InChI=1S/C21H26O4/c22-20(23)13-24-18-11-5-4-10-17(18)21-16-9-2-1-7-14(16)15-8-3-6-12-19(15)25-21/h4-5,7,10-11,15-16,19,21H,1-3,6,8-9,12-13H2,(H,22,23)/p-1/t15-,16-,19+,21+/m0/s1 |
| InChIKey | IUZPOFVYQIAPHI-ZOGSBNJCSA-M |
| XLogP | 3.17 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|