C13H19NO4S — CID 70721367
4-(3-phenylmethoxypropyl)-1,3,4-oxathiazinane 3,3-dioxide (PubChem CID 70721367) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is 4-(3-phenylmethoxypropyl)-1,3,4-oxathiazinane 3,3-dioxide.
| Compound Name | 4-(3-phenylmethoxypropyl)-1,3,4-oxathiazinane 3,3-dioxide |
|---|---|
| PubChem CID | 70721367 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4-(3-phenylmethoxypropyl)-1,3,4-oxathiazinane 3,3-dioxide |
| SMILES | O=S1(=O)COCCN1CCCOCc1ccccc1 |
| InChI | InChI=1S/C13H19NO4S/c15-19(16)12-18-10-8-14(19)7-4-9-17-11-13-5-2-1-3-6-13/h1-3,5-6H,4,7-12H2 |
| InChIKey | CGPBKQDAOBZDSS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|