C17H22N6O2S — CID 70726386
2-[2-[3-(cyclopropylamino)-3-oxopropyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-1,3-thiazole-4-carboxamide (PubChem CID 70726386) has the molecular formula C17H22N6O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is 2-[2-[3-(cyclopropylamino)-3-oxopropyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-[3-(cyclopropylamino)-3-oxopropyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 70726386 |
| Molecular Formula | C17H22N6O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[2-[3-(cyclopropylamino)-3-oxopropyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(N2CCCn3nc(CCC(=O)NC4CC4)cc3C2)n1 |
| InChI | InChI=1S/C17H22N6O2S/c18-16(25)14-10-26-17(20-14)22-6-1-7-23-13(9-22)8-12(21-23)4-5-15(24)19-11-2-3-11/h8,10-11H,1-7,9H2,(H2,18,25)(H,19,24) |
| InChIKey | JTBKZHQTTXTJHX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |