C18H23ClN4OS — CID 70727267
N-[2-(4-chlorophenyl)sulfanylethyl]-3-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-yl)propanamide (PubChem CID 70727267) has the molecular formula C18H23ClN4OS and a molecular weight of 378.93 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-3-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-yl)propanamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-3-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-yl)propanamide |
|---|---|
| PubChem CID | 70727267 |
| Molecular Formula | C18H23ClN4OS |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-3-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-yl)propanamide |
| SMILES | O=C(CCc1cc2n(n1)CCCNC2)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClN4OS/c19-14-2-5-17(6-3-14)25-11-9-21-18(24)7-4-15-12-16-13-20-8-1-10-23(16)22-15/h2-3,5-6,12,20H,1,4,7-11,13H2,(H,21,24) |
| InChIKey | VKVPVHKILVMTLM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|