C32H31N2O2+ — CID 7073050
2-[4-[[(2R)-oxiran-2-yl]methoxy]-1H-indol-3-yl]ethyl-tritylazanium (PubChem CID 7073050) has the molecular formula C32H31N2O2+ and a molecular weight of 475.61 g/mol. Its IUPAC name is 2-[4-[[(2R)-oxiran-2-yl]methoxy]-1H-indol-3-yl]ethyl-tritylazanium.
| Compound Name | 2-[4-[[(2R)-oxiran-2-yl]methoxy]-1H-indol-3-yl]ethyl-tritylazanium |
|---|---|
| PubChem CID | 7073050 |
| Molecular Formula | C32H31N2O2+ |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 2-[4-[[(2R)-oxiran-2-yl]methoxy]-1H-indol-3-yl]ethyl-tritylazanium |
| SMILES | c1ccc(C([NH2+]CCc2c[nH]c3cccc(OC[C@H]4CO4)c23)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H30N2O2/c1-4-11-25(12-5-1)32(26-13-6-2-7-14-26,27-15-8-3-9-16-27)34-20-19-24-21-33-29-17-10-18-30(31(24)29)36-23-28-22-35-28/h1-18,21,28,33-34H,19-20,22-23H2/p+1/t28-/m1/s1 |
| InChIKey | QRZGZLKGADHPCU-MUUNZHRXSA-O |
| XLogP | 5.04 |
| TPSA | 54.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|