C32H30N2O2 — CID 7072108
2-[5-[[(2R)-oxiran-2-yl]methoxy]-1H-indol-3-yl]-N-tritylethanamine (PubChem CID 7072108) has the molecular formula C32H30N2O2 and a molecular weight of 474.60 g/mol. Its IUPAC name is 2-[5-[[(2R)-oxiran-2-yl]methoxy]-1H-indol-3-yl]-N-tritylethanamine.
| Compound Name | 2-[5-[[(2R)-oxiran-2-yl]methoxy]-1H-indol-3-yl]-N-tritylethanamine |
|---|---|
| PubChem CID | 7072108 |
| Molecular Formula | C32H30N2O2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 2-[5-[[(2R)-oxiran-2-yl]methoxy]-1H-indol-3-yl]-N-tritylethanamine |
| SMILES | c1ccc(C(NCCc2c[nH]c3ccc(OC[C@H]4CO4)cc23)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H30N2O2/c1-4-10-25(11-5-1)32(26-12-6-2-7-13-26,27-14-8-3-9-15-27)34-19-18-24-21-33-31-17-16-28(20-30(24)31)35-22-29-23-36-29/h1-17,20-21,29,33-34H,18-19,22-23H2/t29-/m0/s1 |
| InChIKey | SKABPGQSLFTFTE-LJAQVGFWSA-N |
| XLogP | 6.07 |
| TPSA | 49.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|