C19H30N2O2S — CID 70731474
3-[3-(hydroxymethyl)-3-(3-methylbut-2-enyl)piperidin-1-yl]-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 70731474) has the molecular formula C19H30N2O2S and a molecular weight of 350.53 g/mol. Its IUPAC name is 3-[3-(hydroxymethyl)-3-(3-methylbut-2-enyl)piperidin-1-yl]-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-[3-(hydroxymethyl)-3-(3-methylbut-2-enyl)piperidin-1-yl]-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 70731474 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 3-[3-(hydroxymethyl)-3-(3-methylbut-2-enyl)piperidin-1-yl]-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | CC(C)=CCC1(CO)CCCN(CCC(=O)NCc2cccs2)C1 |
| InChI | InChI=1S/C19H30N2O2S/c1-16(2)6-9-19(15-22)8-4-10-21(14-19)11-7-18(23)20-13-17-5-3-12-24-17/h3,5-6,12,22H,4,7-11,13-15H2,1-2H3,(H,20,23) |
| InChIKey | PRCZHKILWAKIIR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|