C16H21N5O — CID 70738692
(3R,4R)-3-cyclobutyl-4-methyl-1-(1-phenyltetrazol-5-yl)pyrrolidin-3-ol (PubChem CID 70738692) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is (3R,4R)-3-cyclobutyl-4-methyl-1-(1-phenyltetrazol-5-yl)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-3-cyclobutyl-4-methyl-1-(1-phenyltetrazol-5-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 70738692 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (3R,4R)-3-cyclobutyl-4-methyl-1-(1-phenyltetrazol-5-yl)pyrrolidin-3-ol |
| SMILES | C[C@@H]1CN(c2nnnn2-c2ccccc2)C[C@@]1(O)C1CCC1 |
| InChI | InChI=1S/C16H21N5O/c1-12-10-20(11-16(12,22)13-6-5-7-13)15-17-18-19-21(15)14-8-3-2-4-9-14/h2-4,8-9,12-13,22H,5-7,10-11H2,1H3/t12-,16+/m1/s1 |
| InChIKey | FXECHYAPDWWVTP-WBMJQRKESA-N |
| XLogP | 1.65 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |