C14H18ClN5O — CID 114780826
6-(chloromethyl)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)morpholine (PubChem CID 114780826) has the molecular formula C14H18ClN5O and a molecular weight of 307.78 g/mol. Its IUPAC name is 6-(chloromethyl)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)morpholine.
| Compound Name | 6-(chloromethyl)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)morpholine |
|---|---|
| PubChem CID | 114780826 |
| Molecular Formula | C14H18ClN5O |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 6-(chloromethyl)-2,2-dimethyl-4-(1-phenyltetrazol-5-yl)morpholine |
| SMILES | CC1(C)CN(c2nnnn2-c2ccccc2)CC(CCl)O1 |
| InChI | InChI=1S/C14H18ClN5O/c1-14(2)10-19(9-12(8-15)21-14)13-16-17-18-20(13)11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3 |
| InChIKey | MGLINHVLUZUHIA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|