C16H25ClN2O — CID 107875644
4-(5-tert-butyl-2-pyridinyl)-6-(chloromethyl)-2,2-dimethylmorpholine (PubChem CID 107875644) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is 4-(5-tert-butyl-2-pyridinyl)-6-(chloromethyl)-2,2-dimethylmorpholine.
| Compound Name | 4-(5-tert-butyl-2-pyridinyl)-6-(chloromethyl)-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 107875644 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 4-(5-tert-butyl-2-pyridinyl)-6-(chloromethyl)-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(c2ccc(C(C)(C)C)cn2)CC(CCl)O1 |
| InChI | InChI=1S/C16H25ClN2O/c1-15(2,3)12-6-7-14(18-9-12)19-10-13(8-17)20-16(4,5)11-19/h6-7,9,13H,8,10-11H2,1-5H3 |
| InChIKey | UCDQKOISLXEEEZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|