C17H23N3O — CID 70740820
1-(cyclobutylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one (PubChem CID 70740820) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one.
| Compound Name | 1-(cyclobutylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 70740820 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-(cyclobutylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one |
| SMILES | O=C1N(CC2CCC2)c2ccccc2NC12CCNCC2 |
| InChI | InChI=1S/C17H23N3O/c21-16-17(8-10-18-11-9-17)19-14-6-1-2-7-15(14)20(16)12-13-4-3-5-13/h1-2,6-7,13,18-19H,3-5,8-12H2 |
| InChIKey | HGHPYRDDNCGCCT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |