About 5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid
5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid (PubChem CID 70741309) has the molecular formula C14H20N2O6S
and a molecular weight of 344.39 g/mol. Its IUPAC name is 5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid |
| PubChem CID | 70741309 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid |
| SMILES | CCC[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)O)n2C)C[C@H]1C(=O)O |
| InChI | InChI=1S/C14H20N2O6S/c1-3-4-9-7-16(8-10(9)13(17)18)23(21,22)12-6-5-11(14(19)20)15(12)2/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,17,18)(H,19,20)/t9-,10-/m1/s1 |
| InChIKey | HBDGVRVKQJICQA-NXEZZACHSA-N |
| XLogP | 0.84 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid?
The IUPAC name of 5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid (CID 70741309) is 5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid.
What is the SMILES notation for 5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid?
The canonical SMILES for 5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid is CCC[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)O)n2C)C[C@H]1C(=O)O.
What is the InChIKey of 5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid?
The InChIKey is HBDGVRVKQJICQA-NXEZZACHSA-N. The full InChI is InChI=1S/C14H20N2O6S/c1-3-4-9-7-16(8-10(9)13(17)18)23(21,22)12-6-5-11(14(19)20)15(12)2/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,17,18)(H,19,20)/t9-,10-/m1/s1.
What are the key properties of 5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid?
5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid has a molecular weight of 344.39 g/mol, XLogP of 0.84, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3S,4S)-3-carboxy-4-propylpyrrolidin-1-yl]sulfonyl-1-methylpyrrole-2-carboxylic acid is sourced from PubChem (CID 70741309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).