C11H19NO3S — CID 57148347
1-[(4R)-1-methylsulfonyl-4-propylpyrrolidin-3-yl]prop-2-en-1-one (PubChem CID 57148347) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is 1-[(4R)-1-methylsulfonyl-4-propylpyrrolidin-3-yl]prop-2-en-1-one.
| Compound Name | 1-[(4R)-1-methylsulfonyl-4-propylpyrrolidin-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 57148347 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1-[(4R)-1-methylsulfonyl-4-propylpyrrolidin-3-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)C1CN(S(C)(=O)=O)C[C@@H]1CCC |
| InChI | InChI=1S/C11H19NO3S/c1-4-6-9-7-12(16(3,14)15)8-10(9)11(13)5-2/h5,9-10H,2,4,6-8H2,1,3H3/t9-,10?/m0/s1 |
| InChIKey | UCCDUZGRCNNUNA-RGURZIINSA-N |
| XLogP | 1.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|